BMS-986020 | B2290

BMS-986020 is a potent G protein-coupled lysophosphatidic acid receptor 1 (LPA1) antagonist. LPA receptor is involved in binding of the signaling molecule lysophosphatidic acid, which in turn is involved in a host of diverse biological functions, such as cell proliferation, platelet aggregation, smooth muscle contraction and others.

BMS-986020 is a potent G protein-coupled lysophosphatidic acid receptor 1 (LPA1) antagonist. LPA receptor is involved in binding of the signaling molecule lysophosphatidic acid, which in turn is involved in a host of diverse biological functions, such as cell proliferation, platelet aggregation, smooth muscle contraction and others.

B2290 | BMS-986020 DataSheet

Alternate Name/Synonyms: 1-[4'-[3-methyl-4-[[[(1R)-1-phenylethoxy]carbonyl]amino]-5-isoxazolyl][1,1'-biphenyl]-4-yl]-cyclopropanecarboxylic acid

Appearance: Crystalline solid

Formulation: N/A

CAS Number: 1257213-50-5

Structure Available?: Yes

Peptide sequence: N/A

Salt Form: No

Molecular Formula: C₂₉H₂₆N₂O₅

Molecular Weight: 482.5

Cell-Permeable?: Yes

Purity: ≥98% by HPLC

Solubilities: DMSO (~20 mg/ml)

Handling: Protect from air and light

Country of Origin: USA

Tag Line: A potent G protein-coupled lysophosphatidic acid receptor 1 (LPA1) antagonist

MDL Number: N/A

PubChem CID: 49792850

SMILES: CC1=NOC(=C1NC(=O)OC(C)C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)C5(CC5)C(=O)O

InChi: InChI=1S/C29H26N2O5/c1-18-25(30-28(34)35-19(2)20-6-4-3-5-7-20)26(36-31-18)23-10-8-21(9-11-23)22-12-14-24(15-13-22)29(16-17-29)27(32)33/h3-15,19H,16-17H2,1-2H3,(H,30,34)(H,32,33)/t19-/m1/s

InChi Key: GQBRZBHEPUQRPL-LJQANCHMSA-N