Additional Information
| Short Description: | Autophagy inhibitor | 
| Research Area: | Cancer, Autophagy | 
| Alternative Name(s): | Hydroxychloroquine sulphate, 7-Chloro-4-[4-(N-ethyl-N-b-hydroxyethylamino)-1-methylbutylamino]quinoline | 
| Category: | Small Molecules | 
| Product Type: | Inhibitor | 
| CAS No.: | 747-36-4 | 
| Molecular Formula: | C18H26ClN3O•H2SO4 | 
| Molecular Weight: | 433,95 | 
| Source: | Synthetic | 
| Purity: | ≥98% | 
| Solubility: | Soluble in greater than 20 mg/ml H2O. | 
| Appearance: | White to off-white powder. | 
| Storage: | -20ºC | 
| Shipping: | Shipped Ambient | 
| SMILES: | C1=C2C(=CC(=C1)Cl)N=CC=C2NC(CCCN(CCO)CC)C.O=[S](O)(O)=O | 
| InChI: | InChI=1S/C18H26ClN3O.H2O4S/c1-3-22(11-12-23)10-4-5-14(2)21-17-8-9-20-18-13-15(19)6-7-16(17)18;1-5(2,3)4/h6-9,13-14,23H,3-5,10-12H2,1-2H3,(H,20,21);(H2,1,2,3,4) | 
| InChIKey: | JCBIVZZPXRZKTI-UHFFFAOYSA-N | 
| Field of Use: | For in vitro research use only. | 
 
             
             
             
             
             
             
             
             
             
            