Additional Information
| Short Description: | Jnk inhibitor | 
| Research Area: | Cell Signaling, Cancer, Apoptosis | 
| Alternative Name(s): | Anthra(1,9-cd)pyrazol-6(2H)-one, 1,9-Pyrazoloanthrone | 
| Category: | Small Molecules | 
| Product Type: | Inhibitor | 
| CAS No.: | 129-56-6 | 
| Molecular Formula: | C14H8N2O | 
| Molecular Weight: | 220,2 | 
| Source: | Synthetic | 
| Purity: | >98% | 
| Solubility: | Soluble in DMSO or methanol | 
| Appearance: | Yellow to brown solid | 
| Storage: | -20ºC | 
| Shipping: | Shipped Ambient | 
| SMILES: | C1=CC=C4C3=C1C(=O)C2=CC=CC=C2C3=N[NH]4 | 
| InChI: | InChI=1S/C14H8N2O/c17-14-9-5-2-1-4-8(9)13-12-10(14)6-3-7-11(12)15-16-13/h1-7H,(H,15,16) | 
| InChIKey: | ACPOUJIDANTYHO-UHFFFAOYSA-N | 
| Field of Use: | For in vitro research use only. | 
 
             
             
             
             
             
             
             
             
             
            