Additional Information
| Short Description: | Akt inhibitor | 
| Research Area: | Cancer, Apoptosis | 
| Alternative Name(s): | (7aS,13aS)-9,10-Dimethoxy-3,3-dimethyl-13,13a-dihydro-3H-chromeno[3,4-b]pyrano[2,3-h]chromen-7(7aH)-one | 
| Category: | Small Molecules | 
| Product Type: | Inducer | 
| CAS No.: | 522-17-8 | 
| Molecular Formula: | C23H22O6 | 
| Molecular Weight: | 394,42 | 
| Source: | Synthetic | 
| Purity: | >98% | 
| Solubility: | Soluble to 50 mM in ethanol and to 100 mM in DMSO | 
| Appearance: | Cream Solid | 
| Storage: | -20ºC | 
| Shipping: | Shipped Ambient | 
| SMILES: | CC1(C=CC2=C(O1)C=CC3=C2O[C@@H]4COC5=CC(=C(C=C5[C@@H]4C3=O)OC)OC)C | 
| InChI: | InChI=1S/C23H22O6/c1-23(2)8-7-12-15(29-23)6-5-13-21(24)20-14-9-17(25-3)18(26-4)10-16(14)27-11-19(20)28-22(12)13/h5-10,19-20H | 
| InChIKey: | ORDAZKGHSNRHTD-UXHICEINSA-N | 
| Field of Use: | For in vitro research use only. | 
 
             
             
             
             
             
             
             
             
             
            