HA14-1 | B1832

HA14-1 is a potent, cell-permeable Bcl-2 inhibitor with potential anticancer activity. HA14-1 induces apoptosis in various human cancer cells. Also binds to the antiapoptotic Blc-2 proteins Bcl-XL and Bcl-w.

HA14-1 is a potent, cell-permeable Bcl-2 inhibitor with potential anticancer activity. HA14-1 induces apoptosis in various human cancer cells. Also binds to the antiapoptotic Blc-2 proteins Bcl-XL and Bcl-w.

B1832 | HA14-1 DataSheet

Alternate Name/Synonyms: 2-Amino-6-bromo-α-cyano-3-(ethoxycarbonyl)-4H-1-benzopyran-4-acetic acid ethyl ester

Appearance: White solid

Formulation: N/A

CAS Number: 65673-63-4

Structure Available?: Yes

Peptide sequence: N/A

Salt Form: N/A

Molecular Formula: C₁₇H₁₇BrN₂O₅

Molecular Weight: 409.23

Cell-Permeable?: Yes

Purity: ≥98% by HPLC

Solubilities: DMSO (>35 mg/ml) or EtOH (>30 mg/ml)

Handling: Protect from air and light

Country of Origin: USA

Tag Line: A potent, cell-permeable Bcl-2 inhibitor with potential anticancer activity.

MDL Number: MFCD00218213

PubChem CID: 3549

SMILES: CCOC(=O)C1=C(OC2=C(C1C(C#N)C(=O)OCC)C=C(C=C2)Br)N

InChi: InChI=1S/C17H17BrN2O5/c1-3-23-16(21)11(8-19)13-10-7-9(18)5-6-12(10)25-15(20)14(13)17(22)24-4-2/h5-7,11,13H,3-4,20H2,1-2H3

InChi Key: SXJDCULZDFWMJC-UHFFFAOYSA-N